C6H5NO5 — CID 58362051
(2,5-dioxopyrrolidin-1-yl) 2-oxoacetate (PubChem CID 58362051) has the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-oxoacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-oxoacetate |
|---|---|
| PubChem CID | 58362051 |
| Molecular Formula | C6H5NO5 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-oxoacetate |
| SMILES | O=CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C6H5NO5/c8-3-6(11)12-7-4(9)1-2-5(7)10/h3H,1-2H2 |
| InChIKey | ZWMFFTQRSNVZLT-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|