C5H8N2O4 — CID 177137018
(2,5-dioxopyrrolidin-1-yl) carbamate;molecular hydrogen (PubChem CID 177137018) has the molecular formula C5H8N2O4 and a molecular weight of 160.13 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) carbamate;molecular hydrogen.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 177137018 |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) carbamate;molecular hydrogen |
| SMILES | NC(=O)ON1C(=O)CCC1=O.[H][H] |
| InChI | InChI=1S/C5H6N2O4.H2/c6-5(10)11-7-3(8)1-2-4(7)9;/h1-2H2,(H2,6,10);1H |
| InChIKey | VGLTUZJHYTYLBK-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|