C7H11NO7 — CID 87408657
(2,5-dioxopyrrolidin-1-yl) hydrogen carbonate;ethane-1,2-diol (PubChem CID 87408657) has the molecular formula C7H11NO7 and a molecular weight of 221.16 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) hydrogen carbonate;ethane-1,2-diol.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) hydrogen carbonate;ethane-1,2-diol |
|---|---|
| PubChem CID | 87408657 |
| Molecular Formula | C7H11NO7 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) hydrogen carbonate;ethane-1,2-diol |
| SMILES | O=C(O)ON1C(=O)CCC1=O.OCCO |
| InChI | InChI=1S/C5H5NO5.C2H6O2/c7-3-1-2-4(8)6(3)11-5(9)10;3-1-2-4/h1-2H2,(H,9,10);3-4H,1-2H2 |
| InChIKey | VQGZJDPQBLSLSZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|