C11H15NO7 — CID 143571418
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;(2,5-dioxopyrrolidin-1-yl) hydrogen carbonate (PubChem CID 143571418) has the molecular formula C11H15NO7 and a molecular weight of 273.24 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;(2,5-dioxopyrrolidin-1-yl) hydrogen carbonate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;(2,5-dioxopyrrolidin-1-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 143571418 |
| Molecular Formula | C11H15NO7 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan;(2,5-dioxopyrrolidin-1-yl) hydrogen carbonate |
| SMILES | C1CC2CCOC2O1.O=C(O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C6H10O2.C5H5NO5/c1-3-7-6-5(1)2-4-8-6;7-3-1-2-4(8)6(3)11-5(9)10/h5-6H,1-4H2;1-2H2,(H,9,10) |
| InChIKey | HECLZSQKPYOTJP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|