C12H10N2O8 — CID 121006912
bis(2,5-dioxopyrrolidin-1-yl) (Z)-but-2-enedioate (PubChem CID 121006912) has the molecular formula C12H10N2O8 and a molecular weight of 310.22 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) (Z)-but-2-enedioate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 121006912 |
| Molecular Formula | C12H10N2O8 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H10N2O8/c15-7-1-2-8(16)13(7)21-11(19)5-6-12(20)22-14-9(17)3-4-10(14)18/h5-6H,1-4H2/b6-5- |
| InChIKey | YDGMGVCDKKUWDQ-WAYWQWQTSA-N |
| XLogP | -1.24 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|