About (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid
(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid (PubChem CID 174926925) has the molecular formula C7H10NO8P
and a molecular weight of 267.13 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid |
| PubChem CID | 174926925 |
| Molecular Formula | C7H10NO8P |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid |
| SMILES | C=CC(=O)ON1C(=O)CCC1=O.O=P(O)(O)O |
| InChI | InChI=1S/C7H7NO4.H3O4P/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-5(2,3)4/h2H,1,3-4H2;(H3,1,2,3,4) |
| InChIKey | MJWGXACWYWZRBP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid (CID 174926925) is (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid is C=CC(=O)ON1C(=O)CCC1=O.O=P(O)(O)O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid?
The InChIKey is MJWGXACWYWZRBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.H3O4P/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-5(2,3)4/h2H,1,3-4H2;(H3,1,2,3,4).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid?
(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid has a molecular weight of 267.13 g/mol, XLogP of -1.15, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid is sourced from PubChem (CID 174926925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).