C7H10NO8P — CID 174926925
(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid (PubChem CID 174926925) has the molecular formula C7H10NO8P and a molecular weight of 267.13 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid |
|---|---|
| PubChem CID | 174926925 |
| Molecular Formula | C7H10NO8P |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;phosphoric acid |
| SMILES | C=CC(=O)ON1C(=O)CCC1=O.O=P(O)(O)O |
| InChI | InChI=1S/C7H7NO4.H3O4P/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-5(2,3)4/h2H,1,3-4H2;(H3,1,2,3,4) |
| InChIKey | MJWGXACWYWZRBP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|