C5H6N2O5 — CID 87500433
(2,5-dioxopyrrolidin-1-yl) N-hydroxycarbamate (PubChem CID 87500433) has the molecular formula C5H6N2O5 and a molecular weight of 174.11 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-hydroxycarbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-hydroxycarbamate |
|---|---|
| PubChem CID | 87500433 |
| Molecular Formula | C5H6N2O5 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-hydroxycarbamate |
| SMILES | O=C(NO)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C5H6N2O5/c8-3-1-2-4(9)7(3)12-5(10)6-11/h11H,1-2H2,(H,6,10) |
| InChIKey | IZRTZBCPRHBZRT-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|