C19H18N4O17 — CID 174941778
bis(bis(2,5-dioxopyrrolidin-1-yl) carbonate);carbonic acid (PubChem CID 174941778) has the molecular formula C19H18N4O17 and a molecular weight of 574.36 g/mol. Its IUPAC name is bis(bis(2,5-dioxopyrrolidin-1-yl) carbonate);carbonic acid.
| Compound Name | bis(bis(2,5-dioxopyrrolidin-1-yl) carbonate);carbonic acid |
|---|---|
| PubChem CID | 174941778 |
| Molecular Formula | C19H18N4O17 |
| Molecular Weight | 574.36 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | bis(bis(2,5-dioxopyrrolidin-1-yl) carbonate);carbonic acid |
| SMILES | O=C(O)O.O=C(ON1C(=O)CCC1=O)ON1C(=O)CCC1=O.O=C(ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/2C9H8N2O7.CH2O3/c2*12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15;2-1(3)4/h2*1-4H2;(H2,2,3,4) |
| InChIKey | GNRMMIFNYLQNDN-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 278.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.36 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|