C12H12N2O10S2 — CID 90051305
(2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyldisulfanyl]methyl carbonate (PubChem CID 90051305) has the molecular formula C12H12N2O10S2 and a molecular weight of 408.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyldisulfanyl]methyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyldisulfanyl]methyl carbonate |
|---|---|
| PubChem CID | 90051305 |
| Molecular Formula | C12H12N2O10S2 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyldisulfanyl]methyl carbonate |
| SMILES | O=C(OCSSCOC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H12N2O10S2/c15-7-1-2-8(16)13(7)23-11(19)21-5-25-26-6-22-12(20)24-14-9(17)3-4-10(14)18/h1-6H2 |
| InChIKey | JUYPIHDSLNHSHE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|