C10H11NO5 — CID 169105698
(2,5-dioxopyrrolidin-1-yl) pent-4-ynyl carbonate (PubChem CID 169105698) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) pent-4-ynyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) pent-4-ynyl carbonate |
|---|---|
| PubChem CID | 169105698 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) pent-4-ynyl carbonate |
| SMILES | C#CCCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H11NO5/c1-2-3-4-7-15-10(14)16-11-8(12)5-6-9(11)13/h1H,3-7H2 |
| InChIKey | BOWJZVLLKVXCJT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|