C11H13NO7 — CID 102051298
2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 2-methylprop-2-enoate (PubChem CID 102051298) has the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102051298 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H13NO7/c1-7(2)10(15)17-5-6-18-11(16)19-12-8(13)3-4-9(12)14/h1,3-6H2,2H3 |
| InChIKey | KCMIPLSJELXLOP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|