C15H26NO9P — CID 122429871
2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 122429871) has the molecular formula C15H26NO9P and a molecular weight of 395.35 g/mol. Its IUPAC name is 2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | 2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 122429871 |
| Molecular Formula | C15H26NO9P |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]ethyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CC(C)(C)OP(=O)(OCCOC(=O)ON1C(=O)CCC1=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26NO9P/c1-14(2,3)24-26(20,25-15(4,5)6)22-10-9-21-13(19)23-16-11(17)7-8-12(16)18/h7-10H2,1-6H3 |
| InChIKey | UDKOCZCBTOBUFK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|