C19H33NO11 — CID 123740028
(2,5-dioxopyrrolidin-1-yl) 2-[2-hydroxy-5-(2-methoxyethoxy)-4-(2-methoxyethoxymethyl)pentoxy]ethyl carbonate (PubChem CID 123740028) has the molecular formula C19H33NO11 and a molecular weight of 451.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-hydroxy-5-(2-methoxyethoxy)-4-(2-methoxyethoxymethyl)pentoxy]ethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-hydroxy-5-(2-methoxyethoxy)-4-(2-methoxyethoxymethyl)pentoxy]ethyl carbonate |
|---|---|
| PubChem CID | 123740028 |
| Molecular Formula | C19H33NO11 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-hydroxy-5-(2-methoxyethoxy)-4-(2-methoxyethoxymethyl)pentoxy]ethyl carbonate |
| SMILES | COCCOCC(COCCOC)CC(O)COCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H33NO11/c1-25-5-7-27-12-15(13-28-8-6-26-2)11-16(21)14-29-9-10-30-19(24)31-20-17(22)3-4-18(20)23/h15-16,21H,3-14H2,1-2H3 |
| InChIKey | QIICKUNPULVQOA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|