C9H13NO6 — CID 59499271
(2,5-dioxopyrrolidin-1-yl) 2,3-dimethoxypropanoate (PubChem CID 59499271) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,3-dimethoxypropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,3-dimethoxypropanoate |
|---|---|
| PubChem CID | 59499271 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,3-dimethoxypropanoate |
| SMILES | COCC(OC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13NO6/c1-14-5-6(15-2)9(13)16-10-7(11)3-4-8(10)12/h6H,3-5H2,1-2H3 |
| InChIKey | NHNKQLBWRRPRSU-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|