C16H25NO8 — CID 88945030
1-O-(2,3-dimethoxypropyl) 3-O-(2,5-dioxopyrrolidin-1-yl) 2-butylpropanedioate (PubChem CID 88945030) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-O-(2,3-dimethoxypropyl) 3-O-(2,5-dioxopyrrolidin-1-yl) 2-butylpropanedioate.
| Compound Name | 1-O-(2,3-dimethoxypropyl) 3-O-(2,5-dioxopyrrolidin-1-yl) 2-butylpropanedioate |
|---|---|
| PubChem CID | 88945030 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-O-(2,3-dimethoxypropyl) 3-O-(2,5-dioxopyrrolidin-1-yl) 2-butylpropanedioate |
| SMILES | CCCCC(C(=O)OCC(COC)OC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H25NO8/c1-4-5-6-12(15(20)24-10-11(23-3)9-22-2)16(21)25-17-13(18)7-8-14(17)19/h11-12H,4-10H2,1-3H3 |
| InChIKey | DZDKUXCYHWVUJE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|