C20H37NO4P+ — CID 102579235
tributyl-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]phosphanium (PubChem CID 102579235) has the molecular formula C20H37NO4P+ and a molecular weight of 386.49 g/mol. Its IUPAC name is tributyl-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]phosphanium.
| Compound Name | tributyl-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]phosphanium |
|---|---|
| PubChem CID | 102579235 |
| Molecular Formula | C20H37NO4P+ |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | tributyl-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H37NO4P/c1-4-7-14-26(15-8-5-2,16-9-6-3)17-10-11-20(24)25-21-18(22)12-13-19(21)23/h4-17H2,1-3H3/q+1 |
| InChIKey | UUZWHTZKCFYPHR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|