C15H18N2O6 — CID 22159166
(2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)heptanoate (PubChem CID 22159166) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)heptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)heptanoate |
|---|---|
| PubChem CID | 22159166 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(2,5-dioxopyrrol-1-yl)heptanoate |
| SMILES | CCC(CCCC(=O)ON1C(=O)CCC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H18N2O6/c1-2-10(16-11(18)6-7-12(16)19)4-3-5-15(22)23-17-13(20)8-9-14(17)21/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | FPWFUXYSYPGEBC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|