C12H13N3O6 — CID 174535443
(2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 174535443) has the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 174535443 |
| Molecular Formula | C12H13N3O6 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-amino-4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | NC(CCC(=O)ON1C(=O)CCC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H13N3O6/c13-7(14-8(16)2-3-9(14)17)1-6-12(20)21-15-10(18)4-5-11(15)19/h2-3,7H,1,4-6,13H2 |
| InChIKey | SVXPXUNCZXENHA-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|