C8H11NO6 — CID 59130156
(2,5-dioxopyrrolidin-1-yl) 2-methoxyethyl carbonate (PubChem CID 59130156) has the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-methoxyethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 59130156 |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H11NO6/c1-13-4-5-14-8(12)15-9-6(10)2-3-7(9)11/h2-5H2,1H3 |
| InChIKey | TWLRVFVQAWWAPO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|