About (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate
(2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate (PubChem CID 155073311) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate.
Molecular Properties
| Compound Name | (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate |
| PubChem CID | 155073311 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate |
| SMILES | C=C1CCC(=O)N1OC(=O)OCC/C(C)=C/C |
| InChI | InChI=1S/C12H17NO4/c1-4-9(2)7-8-16-12(15)17-13-10(3)5-6-11(13)14/h4H,3,5-8H2,1-2H3/b9-4+ |
| InChIKey | JZHVLGRAJNZGAO-RUDMXATFSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate?
The IUPAC name of (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate (CID 155073311) is (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate.
What is the SMILES notation for (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate?
The canonical SMILES for (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate is C=C1CCC(=O)N1OC(=O)OCC/C(C)=C/C.
What is the InChIKey of (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate?
The InChIKey is JZHVLGRAJNZGAO-RUDMXATFSA-N. The full InChI is InChI=1S/C12H17NO4/c1-4-9(2)7-8-16-12(15)17-13-10(3)5-6-11(13)14/h4H,3,5-8H2,1-2H3/b9-4+.
What are the key properties of (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate?
(2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate has a molecular weight of 239.27 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylidene-5-oxopyrrolidin-1-yl) [(E)-3-methylpent-3-enyl] carbonate is sourced from PubChem (CID 155073311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).