C15H20N2O8 — CID 90373410
(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2-methylprop-2-enoylamino)pentanoate (PubChem CID 90373410) has the molecular formula C15H20N2O8 and a molecular weight of 356.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2-methylprop-2-enoylamino)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2-methylprop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 90373410 |
| Molecular Formula | C15H20N2O8 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 5-(2-methylprop-2-enoylamino)pentanoate |
| SMILES | C=C(C)C(=O)NCCCCC(=O)OCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H20N2O8/c1-10(2)14(21)16-8-4-3-5-13(20)23-9-24-15(22)25-17-11(18)6-7-12(17)19/h1,3-9H2,2H3,(H,16,21) |
| InChIKey | MEXOUWRRVDIQTB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|