C17H24N4O8 — CID 78324260
(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoate (PubChem CID 78324260) has the molecular formula C17H24N4O8 and a molecular weight of 412.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 78324260 |
| Molecular Formula | C17H24N4O8 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl 6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoate |
| SMILES | CC1(CCC(=O)NCCCCCC(=O)OCOC(=O)ON2C(=O)CCC2=O)N=N1 |
| InChI | InChI=1S/C17H24N4O8/c1-17(19-20-17)9-8-12(22)18-10-4-2-3-5-15(25)27-11-28-16(26)29-21-13(23)6-7-14(21)24/h2-11H2,1H3,(H,18,22) |
| InChIKey | SYNOPMXKNGQIQL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|