C12H20N6O2 — CID 170917059
3-(3-methyldiazirin-3-yl)-N-[2-[3-(3-methyldiazirin-3-yl)propanoylamino]ethyl]propanamide (PubChem CID 170917059) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-(3-methyldiazirin-3-yl)-N-[2-[3-(3-methyldiazirin-3-yl)propanoylamino]ethyl]propanamide.
| Compound Name | 3-(3-methyldiazirin-3-yl)-N-[2-[3-(3-methyldiazirin-3-yl)propanoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 170917059 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(3-methyldiazirin-3-yl)-N-[2-[3-(3-methyldiazirin-3-yl)propanoylamino]ethyl]propanamide |
| SMILES | CC1(CCC(=O)NCCNC(=O)CCC2(C)N=N2)N=N1 |
| InChI | InChI=1S/C12H20N6O2/c1-11(15-16-11)5-3-9(19)13-7-8-14-10(20)4-6-12(2)17-18-12/h3-8H2,1-2H3,(H,13,19)(H,14,20) |
| InChIKey | MHCPZAAGNVISCN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|