C33H41N3O5 — CID 172990068
N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxyhexyl]-3-(3-methyldiazirin-3-yl)propanamide (PubChem CID 172990068) has the molecular formula C33H41N3O5 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxyhexyl]-3-(3-methyldiazirin-3-yl)propanamide.
| Compound Name | N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxyhexyl]-3-(3-methyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 172990068 |
| Molecular Formula | C33H41N3O5 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-hydroxyhexyl]-3-(3-methyldiazirin-3-yl)propanamide |
| SMILES | COc1ccc(C(OCC(CO)CCCCNC(=O)CCC2(C)N=N2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H41N3O5/c1-32(35-36-32)21-20-31(38)34-22-8-7-9-25(23-37)24-41-33(26-10-5-4-6-11-26,27-12-16-29(39-2)17-13-27)28-14-18-30(40-3)19-15-28/h4-6,10-19,25,37H,7-9,20-24H2,1-3H3,(H,34,38) |
| InChIKey | CGFDTIXYYARUPA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|