C42H55NO7S2 — CID 90168126
[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-[5-(dithiolan-3-yl)pentanoylamino]hexyl] 4-oxohexanoate (PubChem CID 90168126) has the molecular formula C42H55NO7S2 and a molecular weight of 750.04 g/mol. Its IUPAC name is [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-[5-(dithiolan-3-yl)pentanoylamino]hexyl] 4-oxohexanoate.
| Compound Name | [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-[5-(dithiolan-3-yl)pentanoylamino]hexyl] 4-oxohexanoate |
|---|---|
| PubChem CID | 90168126 |
| Molecular Formula | C42H55NO7S2 |
| Molecular Weight | 750.04 g/mol |
| Exact Mass | 749.34 |
| IUPAC Name | [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-[5-(dithiolan-3-yl)pentanoylamino]hexyl] 4-oxohexanoate |
| SMILES | CCC(=O)CCC(=O)OCC(CCCCNC(=O)CCCCC1CCSS1)COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C42H55NO7S2/c1-4-36(44)21-26-41(46)49-30-32(12-10-11-28-43-40(45)16-9-8-15-39-27-29-51-52-39)31-50-42(33-13-6-5-7-14-33,34-17-22-37(47-2)23-18-34)35-19-24-38(48-3)25-20-35/h5-7,13-14,17-20,22-25,32,39H,4,8-12,15-16,21,26-31H2,1-3H3,(H,43,45) |
| InChIKey | OETPNKXIPOSDPI-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.04 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|