C23H38N2O2S2 — CID 143267194
5-(dithiolan-3-yl)-N-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]pentanamide (PubChem CID 143267194) has the molecular formula C23H38N2O2S2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]pentanamide |
|---|---|
| PubChem CID | 143267194 |
| Molecular Formula | C23H38N2O2S2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[5-[ethyl-[(2-methoxyphenyl)methyl]amino]pentyl]pentanamide |
| SMILES | CCN(CCCCCNC(=O)CCCCC1CCSS1)Cc1ccccc1OC |
| InChI | InChI=1S/C23H38N2O2S2/c1-3-25(19-20-11-5-7-13-22(20)27-2)17-10-4-9-16-24-23(26)14-8-6-12-21-15-18-28-29-21/h5,7,11,13,21H,3-4,6,8-10,12,14-19H2,1-2H3,(H,24,26) |
| InChIKey | BACSLAVYZITMAG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|