C19H29N3O3S2 — CID 51348159
N-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]ethyl]-2-hydroxybenzamide (PubChem CID 51348159) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 51348159 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]ethyl]-2-hydroxybenzamide |
| SMILES | O=C(CCCCC1CCSS1)NCCNCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C19H29N3O3S2/c23-17-7-3-2-6-16(17)19(25)22-13-11-20-10-12-21-18(24)8-4-1-5-15-9-14-26-27-15/h2-3,6-7,15,20,23H,1,4-5,8-14H2,(H,21,24)(H,22,25) |
| InChIKey | SQRPXCGDNBGTNS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|