C20H26N4O4 — CID 101177175
2-hydroxy-N-[2-[2-[2-[(2-hydroxybenzoyl)amino]ethylamino]ethylamino]ethyl]benzamide (PubChem CID 101177175) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[2-[2-[(2-hydroxybenzoyl)amino]ethylamino]ethylamino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[2-[2-[(2-hydroxybenzoyl)amino]ethylamino]ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 101177175 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-hydroxy-N-[2-[2-[2-[(2-hydroxybenzoyl)amino]ethylamino]ethylamino]ethyl]benzamide |
| SMILES | O=C(NCCNCCNCCNC(=O)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C20H26N4O4/c25-17-7-3-1-5-15(17)19(27)23-13-11-21-9-10-22-12-14-24-20(28)16-6-2-4-8-18(16)26/h1-8,21-22,25-26H,9-14H2,(H,23,27)(H,24,28) |
| InChIKey | TULWCXXKXAUNAV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|