C13H16N2O4 — CID 108571704
prop-2-enyl N-[2-[(2-hydroxybenzoyl)amino]ethyl]carbamate (PubChem CID 108571704) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is prop-2-enyl N-[2-[(2-hydroxybenzoyl)amino]ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[(2-hydroxybenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108571704 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | prop-2-enyl N-[2-[(2-hydroxybenzoyl)amino]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C13H16N2O4/c1-2-9-19-13(18)15-8-7-14-12(17)10-5-3-4-6-11(10)16/h2-6,16H,1,7-9H2,(H,14,17)(H,15,18) |
| InChIKey | LFLUXHGONICOIP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|