C12H15N3O3 — CID 108574875
prop-2-enyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate (PubChem CID 108574875) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is prop-2-enyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108574875 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | prop-2-enyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCNC(=O)c1ccccn1 |
| InChI | InChI=1S/C12H15N3O3/c1-2-9-18-12(17)15-8-7-14-11(16)10-5-3-4-6-13-10/h2-6H,1,7-9H2,(H,14,16)(H,15,17) |
| InChIKey | OUEDJWQWSXBBSQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|