C17H17N3O2 — CID 108574860
N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]pyridine-2-carboxamide (PubChem CID 108574860) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 108574860 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]pyridine-2-carboxamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCNC(=O)c1ccccn1 |
| InChI | InChI=1S/C17H17N3O2/c21-16(10-9-14-6-2-1-3-7-14)19-12-13-20-17(22)15-8-4-5-11-18-15/h1-11H,12-13H2,(H,19,21)(H,20,22)/b10-9+ |
| InChIKey | WJWCBCUVBFEQOL-MDZDMXLPSA-N |
| XLogP | 1.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|