C15H19N3O3 — CID 108562791
prop-2-enyl 4-(pyridine-2-carbonylamino)piperidine-1-carboxylate (PubChem CID 108562791) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is prop-2-enyl 4-(pyridine-2-carbonylamino)piperidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-(pyridine-2-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108562791 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | prop-2-enyl 4-(pyridine-2-carbonylamino)piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(NC(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C15H19N3O3/c1-2-11-21-15(20)18-9-6-12(7-10-18)17-14(19)13-5-3-4-8-16-13/h2-5,8,12H,1,6-7,9-11H2,(H,17,19) |
| InChIKey | HIBQMOGGOJWMOL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|