C14H18N2O4 — CID 108559625
prop-2-enyl 4-(furan-2-carbonylamino)piperidine-1-carboxylate (PubChem CID 108559625) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is prop-2-enyl 4-(furan-2-carbonylamino)piperidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-(furan-2-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108559625 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | prop-2-enyl 4-(furan-2-carbonylamino)piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(NC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C14H18N2O4/c1-2-9-20-14(18)16-7-5-11(6-8-16)15-13(17)12-4-3-10-19-12/h2-4,10-11H,1,5-9H2,(H,15,17) |
| InChIKey | MNKYRPKCZOBMKD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|