C14H17N3O5 — CID 3806765
prop-2-enyl 2-[2-(furan-2-carbonylamino)acetyl]pyrazolidine-1-carboxylate (PubChem CID 3806765) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(furan-2-carbonylamino)acetyl]pyrazolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(furan-2-carbonylamino)acetyl]pyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 3806765 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | prop-2-enyl 2-[2-(furan-2-carbonylamino)acetyl]pyrazolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCN1C(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H17N3O5/c1-2-8-22-14(20)17-7-4-6-16(17)12(18)10-15-13(19)11-5-3-9-21-11/h2-3,5,9H,1,4,6-8,10H2,(H,15,19) |
| InChIKey | JQIQGNMNALLPHT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|