C18H19N3O4 — CID 108557881
N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]pyridine-2-carboxamide (PubChem CID 108557881) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]pyridine-2-carboxamide.
| Compound Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 108557881 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(O)cc(O)c2)CC1)c1ccccn1 |
| InChI | InChI=1S/C18H19N3O4/c22-14-9-12(10-15(23)11-14)18(25)21-7-4-13(5-8-21)20-17(24)16-3-1-2-6-19-16/h1-3,6,9-11,13,22-23H,4-5,7-8H2,(H,20,24) |
| InChIKey | AJFOKJHIUUOKKH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |