C21H24N2O4 — CID 108557638
N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-3,4-dimethylbenzamide (PubChem CID 108557638) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 108557638 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)c3cc(O)cc(O)c3)CC2)cc1C |
| InChI | InChI=1S/C21H24N2O4/c1-13-3-4-15(9-14(13)2)20(26)22-17-5-7-23(8-6-17)21(27)16-10-18(24)12-19(25)11-16/h3-4,9-12,17,24-25H,5-8H2,1-2H3,(H,22,26) |
| InChIKey | YUQYIESLEPWWJH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |