C21H24N2O6 — CID 108558147
N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide (PubChem CID 108558147) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108558147 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-3,5-dihydroxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(NC(=O)c3cc(O)cc(O)c3)CC2)c1 |
| InChI | InChI=1S/C21H24N2O6/c1-28-18-9-14(10-19(12-18)29-2)21(27)23-5-3-15(4-6-23)22-20(26)13-7-16(24)11-17(25)8-13/h7-12,15,24-25H,3-6H2,1-2H3,(H,22,26) |
| InChIKey | VUBHKLTXZYNPLA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |