C19H29N3O4 — CID 108559836
4-[(3,5-dimethoxybenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide (PubChem CID 108559836) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-[(3,5-dimethoxybenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide.
| Compound Name | 4-[(3,5-dimethoxybenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108559836 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 4-[(3,5-dimethoxybenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(NC(=O)c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C19H29N3O4/c1-5-21(6-2)19(24)22-9-7-15(8-10-22)20-18(23)14-11-16(25-3)13-17(12-14)26-4/h11-13,15H,5-10H2,1-4H3,(H,20,23) |
| InChIKey | KOBSCUAGLYEPCO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |