C17H24BrN3O2 — CID 108559685
4-[(2-bromobenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide (PubChem CID 108559685) has the molecular formula C17H24BrN3O2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 4-[(2-bromobenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide.
| Compound Name | 4-[(2-bromobenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108559685 |
| Molecular Formula | C17H24BrN3O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-[(2-bromobenzoyl)amino]-N,N-diethylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(NC(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H24BrN3O2/c1-3-20(4-2)17(23)21-11-9-13(10-12-21)19-16(22)14-7-5-6-8-15(14)18/h5-8,13H,3-4,9-12H2,1-2H3,(H,19,22) |
| InChIKey | GYXDLFVUFHPYFI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |