C21H30BrN3O2 — CID 3230384
2-bromo-N-[1-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]piperidin-4-yl]benzamide (PubChem CID 3230384) has the molecular formula C21H30BrN3O2 and a molecular weight of 436.39 g/mol. Its IUPAC name is 2-bromo-N-[1-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]piperidin-4-yl]benzamide.
| Compound Name | 2-bromo-N-[1-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 3230384 |
| Molecular Formula | C21H30BrN3O2 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-bromo-N-[1-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]piperidin-4-yl]benzamide |
| SMILES | CN(C(=O)CN1CCC(NC(=O)c2ccccc2Br)CC1)C1CCCCC1 |
| InChI | InChI=1S/C21H30BrN3O2/c1-24(17-7-3-2-4-8-17)20(26)15-25-13-11-16(12-14-25)23-21(27)18-9-5-6-10-19(18)22/h5-6,9-10,16-17H,2-4,7-8,11-15H2,1H3,(H,23,27) |
| InChIKey | GZDDMTAOFOAYSO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |