C17H25N3O3 — CID 108562959
N,N-diethyl-4-[(3-hydroxybenzoyl)amino]piperidine-1-carboxamide (PubChem CID 108562959) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-hydroxybenzoyl)amino]piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[(3-hydroxybenzoyl)amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108562959 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N,N-diethyl-4-[(3-hydroxybenzoyl)amino]piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(NC(=O)c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-19(4-2)17(23)20-10-8-14(9-11-20)18-16(22)13-6-5-7-15(21)12-13/h5-7,12,14,21H,3-4,8-11H2,1-2H3,(H,18,22) |
| InChIKey | ZXBDMNYUTIUASL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |