C17H23ClN2O4 — CID 108564100
2-chloro-N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]propanamide (PubChem CID 108564100) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 2-chloro-N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]propanamide.
| Compound Name | 2-chloro-N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108564100 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-chloro-N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]propanamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(NC(=O)C(C)Cl)CC2)c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-11(18)16(21)19-13-4-6-20(7-5-13)17(22)12-8-14(23-2)10-15(9-12)24-3/h8-11,13H,4-7H2,1-3H3,(H,19,21) |
| InChIKey | YKHFHGJBJAHGGW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|