C22H24N2O6 — CID 108557265
N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 108557265) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 108557265 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(NC(=O)c3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C22H24N2O6/c1-27-17-9-15(10-18(12-17)28-2)22(26)24-7-5-16(6-8-24)23-21(25)14-3-4-19-20(11-14)30-13-29-19/h3-4,9-12,16H,5-8,13H2,1-2H3,(H,23,25) |
| InChIKey | MZQDZPANJUTSGG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |