C15H18N2O5 — CID 110821823
methyl 4-(1,3-benzodioxole-5-carbonylamino)piperidine-1-carboxylate (PubChem CID 110821823) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxole-5-carbonylamino)piperidine-1-carboxylate.
| Compound Name | methyl 4-(1,3-benzodioxole-5-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110821823 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | methyl 4-(1,3-benzodioxole-5-carbonylamino)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H18N2O5/c1-20-15(19)17-6-4-11(5-7-17)16-14(18)10-2-3-12-13(8-10)22-9-21-12/h2-3,8,11H,4-7,9H2,1H3,(H,16,18) |
| InChIKey | JEJSVDFSDLBJPH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |