C16H22N2O3 — CID 51194544
N-(1-propan-2-ylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 51194544) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-(1-propan-2-ylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(1-propan-2-ylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 51194544 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-(1-propan-2-ylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)N1CCC(NC(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H22N2O3/c1-11(2)18-7-5-13(6-8-18)17-16(19)12-3-4-14-15(9-12)21-10-20-14/h3-4,9,11,13H,5-8,10H2,1-2H3,(H,17,19) |
| InChIKey | GHZDKIXQDFTZTO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |