C13H16N2O5S — CID 110866984
N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 110866984) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110866984 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H16N2O5S/c1-21(17,18)15-5-4-10(7-15)14-13(16)9-2-3-11-12(6-9)20-8-19-11/h2-3,6,10H,4-5,7-8H2,1H3,(H,14,16) |
| InChIKey | LENUFNRAFMFPCW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |