C12H16N2O6S2 — CID 110871310
N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110871310) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110871310 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-(1-methylsulfonylpyrrolidin-3-yl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | CS(=O)(=O)N1CCC(NS(=O)(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C12H16N2O6S2/c1-21(15,16)14-5-4-9(7-14)13-22(17,18)10-2-3-11-12(6-10)20-8-19-11/h2-3,6,9,13H,4-5,7-8H2,1H3 |
| InChIKey | QSQUAPSTCZIHMW-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |