C12H16Cl2N2O4S2 — CID 55572265
3,4-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzenesulfonamide (PubChem CID 55572265) has the molecular formula C12H16Cl2N2O4S2 and a molecular weight of 387.31 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55572265 |
| Molecular Formula | C12H16Cl2N2O4S2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 3,4-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CS(=O)(=O)N1CCC(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H16Cl2N2O4S2/c1-21(17,18)16-6-4-9(5-7-16)15-22(19,20)10-2-3-11(13)12(14)8-10/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | IRIBIEQQSDMJFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |