C11H14Cl2N2O2S — CID 28810999
3,4-dichloro-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 28810999) has the molecular formula C11H14Cl2N2O2S and a molecular weight of 309.22 g/mol. Its IUPAC name is 3,4-dichloro-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 3,4-dichloro-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 28810999 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3,4-dichloro-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCNCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2S/c12-10-2-1-9(7-11(10)13)18(16,17)15-8-3-5-14-6-4-8/h1-2,7-8,14-15H,3-6H2 |
| InChIKey | DEBGTJCCEHEKME-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |