C12H17FN2O4S2 — CID 119960411
3-fluoro-4-methylsulfonyl-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 119960411) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-fluoro-4-methylsulfonyl-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 3-fluoro-4-methylsulfonyl-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 119960411 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-fluoro-4-methylsulfonyl-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NC2CCNCC2)cc1F |
| InChI | InChI=1S/C12H17FN2O4S2/c1-20(16,17)12-3-2-10(8-11(12)13)21(18,19)15-9-4-6-14-7-5-9/h2-3,8-9,14-15H,4-7H2,1H3 |
| InChIKey | SCQMYWQBGSKATN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |